Geranylgeraniol
cas: 24034-73-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Geranylgeraniol (CAS 24034-73-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 2g, 5g, 25g, 10g, 100MG. Oferty producentów: Biosynth, Sigma-Aldrich.
| producent | Biosynth |
|---|---|
| nr katalogowy | FG23658-1g |
| cas | 24034-73-9 |
| opakowanie | 1g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Biosynth | 1g | cena na żądanie | |
| Biosynth | 2g | cena na żądanie | |
| Biosynth | 5g | cena na żądanie | |
| Biosynth | 25g | cena na żądanie | |
| Biosynth | 10g | cena na żądanie | |
| Sigma-Aldrich | 100MG | 393,00 Pln |
właściwości
| kategoria | Natural Products |
|---|---|
| podkategoria 1 | Terpenes |
| czystość | No data |
| czas dostawy | 1-2 tygodnie |
(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-ol (CAS 24034-73-9) to związek chemiczny o wzorze sumarycznym C20H34O i masie molowej 290.5 g/mol. Nazwa systematyczna IUPAC: (2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-ol. InChIKey: OJISWRZIEWCUBN-QIRCYJPOSA-N.
| Wzór sumaryczny | C20H34O |
|---|---|
| Masa molowa | 290.5 g/mol |
| Nazwa IUPAC | (2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-ol |
| InChIKey | OJISWRZIEWCUBN-QIRCYJPOSA-N |
| SMILES | CC(=CCC/C(=C/CC/C(=C/CC/C(=C/CO)/C)/C)/C)C |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Geranylgeraniol, (2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-ol, 2,6,10,14-Hexadecatetraen-1-ol, 3,7,11,15-tetramethyl-, 3,7,11,15-tetramethylhexadeca-2E,6E,10E,14-tetraen-1-ol, Geranyl geraniol, (E,E,E)-Geranylgeraniol, trans-Geranylgeraniol, (E,E,E)-Geranylgeranyl alcohol, All-trans-Geranylgeraniol, Geranylgeraniol (Natural)