Glutathione synthesis-IN-1, 98.32%
cas: 2632968-72-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Glutathione synthesis-IN-1, 98.32% (CAS 2632968-72-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10mM/1mL, 50 mg, 100 mg, 10 mg, 25 mg, 5 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-144868-10mM/1mL |
| cas | 2632968-72-8 |
| opakowanie | 10mM/1mL |
| dostępność | In stock |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 1281,00 Pln | |
| MedChemExpress | 50 mg | 3189,68 Pln | |
| MedChemExpress | 100 mg | 5038,00 Pln | |
| MedChemExpress | 10 mg | 1801,13 Pln | |
| MedChemExpress | 25 mg | 2037,97 Pln | |
| MedChemExpress | 5 mg | 1174,19 Pln |
właściwości
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 98.32% |
2-hydroxy-5-[(E)-2-(4-phenylphenyl)ethenyl]benzoic acid (CAS 2632968-72-8) to związek chemiczny o wzorze sumarycznym C21H16O3 i masie molowej 316.3 g/mol. Nazwa systematyczna IUPAC: 2-hydroxy-5-[(E)-2-(4-phenylphenyl)ethenyl]benzoic acid. InChIKey: PTIOBWXSSXHDCF-VOTSOKGWSA-N.
| Wzór sumaryczny | C21H16O3 |
|---|---|
| Masa molowa | 316.3 g/mol |
| Nazwa IUPAC | 2-hydroxy-5-[(E)-2-(4-phenylphenyl)ethenyl]benzoic acid |
| InChIKey | PTIOBWXSSXHDCF-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)/C=C/C3=CC(=C(C=C3)O)C(=O)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Glutathione synthesis-IN-1, (E)-5-(2-([1,1'-Biphenyl]-4-yl)vinyl)-2-hydroxybenzoic acid, Glutathione synthesis-IN-1?, orb1685180, Glutathione synthesisIN1,Glutathione synthesis IN 1, 2-hydroxy-5-[(E)-2-(4-phenylphenyl)ethenyl]benzoic acid, 5-[(1E)-2-{[1,1'-biphenyl]-4-yl}ethenyl]-2-hydroxybenzoic acid, Benzoic acid, 5-[(1E)-2-[1,1'-biphenyl]-4-ylethenyl]-2-hydroxy-