H-N-Me-Leu-OMe·HCl, 95%
cas: 3339-45-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
H-N-Me-Leu-OMe·HCl, 95% (CAS 3339-45-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 25g. Oferty producentów: Ambeed.
| producent | Ambeed |
|---|---|
| nr katalogowy | A681978-250mg |
| cas | 3339-45-5 |
| opakowanie | 250mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 186,81 Pln | |
| Ambeed | 1g | 359,25 Pln | |
| Ambeed | 5g | 1021,19 Pln | |
| Ambeed | 25g | 3401,94 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 1-2 tygodnie |
Methyl (2S)-4-methyl-2-(methylamino)pentanoate;hydrochloride (CAS 3339-45-5) to związek chemiczny o wzorze sumarycznym C8H18ClNO2 i masie molowej 195.69 g/mol. Nazwa systematyczna IUPAC: methyl (2S)-4-methyl-2-(methylamino)pentanoate;hydrochloride. InChIKey: VKYPGIMVFQAVJF-FJXQXJEOSA-N.
| Wzór sumaryczny | C8H18ClNO2 |
|---|---|
| Masa molowa | 195.69 g/mol |
| Nazwa IUPAC | methyl (2S)-4-methyl-2-(methylamino)pentanoate;hydrochloride |
| InChIKey | VKYPGIMVFQAVJF-FJXQXJEOSA-N |
| SMILES | CC(C)C[C@@H](C(=O)OC)NC.Cl |
Dane obliczone przez PubChem (NCBI)
Synonimy:
(S)-Methyl 4-methyl-2-(methylamino)pentanoate hydrochloride, methyl (2S)-4-methyl-2-(methylamino)pentanoate hydrochloride, Methyl methyl-L-leucinate hydrochloride, Methyl N-methyl-L-leucinate hydrochloride, methyl (2S)-4-methyl-2-(methylamino)pentanoate;hydrochloride, N-Me-Leu-OMe.HCl, N-Me-Leu-OMemiddotHCl, Methylmethyl-L-leucinatehydrochloride, (S)-Methyl 4-methyl-2-(methylamino)pentanoate HCl, N-Me-Leu-OMe inverted exclamation mark currencyHCl