H-O2Oc-OtBu*HCI
cas: 2098500-69-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
H-O2Oc-OtBu*HCI (CAS 2098500-69-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 5g, 25g, 250mg, 500mg. Oferty producentów: Iris Biotech.
| producent | Iris Biotech |
|---|---|
| nr katalogowy | PEG2430.0001 |
| cas | 2098500-69-5 |
| opakowanie | 1g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Iris Biotech | 1g | 952,69 Pln | |
| Iris Biotech | 5g | 3119,60 Pln | |
| Iris Biotech | 25g | 12148,40 Pln | |
| Iris Biotech | 250mg | 511,28 Pln | |
| Iris Biotech | 500mg | 651,73 Pln |
właściwości
| czystość | No data |
|---|---|
| czas dostawy | 2 tygodnie |
Tert-butyl 2-[2-(2-aminoethoxy)ethoxy]acetate;hydrochloride (CAS 2098500-69-5) to związek chemiczny o wzorze sumarycznym C10H22ClNO4 i masie molowej 255.74 g/mol. Nazwa systematyczna IUPAC: tert-butyl 2-[2-(2-aminoethoxy)ethoxy]acetate;hydrochloride. InChIKey: XSFSGLLUAPLBAX-UHFFFAOYSA-N.
| Wzór sumaryczny | C10H22ClNO4 |
|---|---|
| Masa molowa | 255.74 g/mol |
| Nazwa IUPAC | tert-butyl 2-[2-(2-aminoethoxy)ethoxy]acetate;hydrochloride |
| InChIKey | XSFSGLLUAPLBAX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCCN.Cl |
Dane obliczone przez PubChem (NCBI)
Synonimy:
tert-Butyl 2-(2-(2-aminoethoxy)ethoxy)acetate hydrochloride, 8-Amino-3,6-dioxaoctanoic acid t-butyl ester hydrochloride, tert-butyl 2-[2-(2-aminoethoxy)ethoxy]acetate;hydrochloride, 8-Amino-3,6-dioxaoctanoic acid tert-butyl ester hydrochloride, orb3175412, tert-Butyl 8-Amino-3,6-dioxaoctanoate HCl, 8-Amino-3,6-dioxaoctanoicacidtert-butylesterhydrochloride