cas: 4091-99-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
H2DCFDA, 99.82% (CAS 4091-99-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 500 mg, 100 mg, 50 mg, 10 mg, 1 g, 5 mg, 250 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-D0940-500 mg |
| cas | 4091-99-0 |
| opakowanie | 500 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 500 mg | 1392,46 Pln | |
| MedChemExpress | 100 mg | 407,93 Pln | |
| MedChemExpress | 50 mg | 333,62 Pln | |
| MedChemExpress | 10 mg | 240,74 Pln | |
| MedChemExpress | 1 g | 2637,05 Pln | |
| MedChemExpress | 5 mg | 217,52 Pln | |
| MedChemExpress | 250 mg | 765,52 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.82% |
2-(3,6-diacetyloxy-2,7-dichloro-9H-xanthen-9-yl)benzoic acid (CAS 4091-99-0) to związek chemiczny o wzorze sumarycznym C24H16Cl2O7 i masie molowej 487.3 g/mol. Nazwa systematyczna IUPAC: 2-(3,6-diacetyloxy-2,7-dichloro-9H-xanthen-9-yl)benzoic acid. InChIKey: PXEZTIWVRVSYOK-UHFFFAOYSA-N.
| Wzór sumaryczny | C24H16Cl2O7 |
|---|---|
| Masa molowa | 487.3 g/mol |
| Nazwa IUPAC | 2-(3,6-diacetyloxy-2,7-dichloro-9H-xanthen-9-yl)benzoic acid |
| InChIKey | PXEZTIWVRVSYOK-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C2C(C3=CC(=C(C=C3OC2=C1)OC(=O)C)Cl)C4=CC=CC=C4C(=O)O)Cl |
Dane obliczone przez PubChem (NCBI)