cas: 2243942-52-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
HO-PEG24-OH, 95% (CAS 2243942-52-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g. Oferty producentów: Ambeed.
| producent | Ambeed |
|---|---|
| nr katalogowy | A755217-250mg |
| cas | 2243942-52-9 |
| opakowanie | 250mg |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 250mg | 1443,94 Pln | |
| Ambeed | 1g | 3891,44 Pln | |
| Ambeed | 5g | 11328,50 Pln |
| czystość | 95% |
|---|---|
| czas dostawy | 1-2 tygodnie |
2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol (CAS 2243942-52-9) to związek chemiczny o wzorze sumarycznym C48H98O25 i masie molowej 1075.3 g/mol. Nazwa systematyczna IUPAC: 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol. InChIKey: IEXKUCOGQITOPO-UHFFFAOYSA-N.
| Wzór sumaryczny | C48H98O25 |
|---|---|
| Masa molowa | 1075.3 g/mol |
| Nazwa IUPAC | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| InChIKey | IEXKUCOGQITOPO-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCO)O |
Dane obliczone przez PubChem (NCBI)