cas: 79983-71-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Hexaconazole, 98.11% (CAS 79983-71-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10 g, 5 g, 1 g, 500 mg, 10mM/1mL, 50 mg, 100 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-A0278-10 g |
| cas | 79983-71-4 |
| opakowanie | 10 g |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10 g | 1053,44 Pln | |
| MedChemExpress | 5 g | 863,04 Pln | |
| MedChemExpress | 1 g | 505,45 Pln | |
| MedChemExpress | 500 mg | 431,15 Pln | |
| MedChemExpress | 10mM/1mL | 277,90 Pln | |
| MedChemExpress | 50 mg | 263,96 Pln | |
| MedChemExpress | 100 mg | 333,62 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 98.11% |
2-(2,4-dichlorophenyl)-1-(1,2,4-triazol-1-yl)hexan-2-ol (CAS 79983-71-4) to związek chemiczny o wzorze sumarycznym C14H17Cl2N3O i masie molowej 314.2 g/mol. Nazwa systematyczna IUPAC: 2-(2,4-dichlorophenyl)-1-(1,2,4-triazol-1-yl)hexan-2-ol. InChIKey: STMIIPIFODONDC-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H17Cl2N3O |
|---|---|
| Masa molowa | 314.2 g/mol |
| Nazwa IUPAC | 2-(2,4-dichlorophenyl)-1-(1,2,4-triazol-1-yl)hexan-2-ol |
| InChIKey | STMIIPIFODONDC-UHFFFAOYSA-N |
| SMILES | CCCCC(CN1C=NC=N1)(C2=C(C=C(C=C2)Cl)Cl)O |
Dane obliczone przez PubChem (NCBI)