cas: 5662-81-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Hydroxy-PEG3-SS-PEG3-alcohol (CAS 5662-81-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250 mg, 100 mg, 10 mg, 5 mg, 1 g, 25 mg, 50 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-130546-250 mg |
| cas | 5662-81-7 |
| opakowanie | 250 mg |
| dostępność | In stock |
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 250 mg | 1777,91 Pln | |
| MedChemExpress | 100 mg | 1104,53 Pln | |
| MedChemExpress | 10 mg | 347,56 Pln | |
| MedChemExpress | 5 mg | 273,25 Pln | |
| MedChemExpress | 1 g | 4592,17 Pln | |
| MedChemExpress | 25 mg | 528,67 Pln | |
| MedChemExpress | 50 mg | 751,58 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | no data |
2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyldisulfanyl]ethoxy]ethoxy]ethoxy]ethanol (CAS 5662-81-7) to związek chemiczny o wzorze sumarycznym C16H34O8S2 i masie molowej 418.6 g/mol. Nazwa systematyczna IUPAC: 2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyldisulfanyl]ethoxy]ethoxy]ethoxy]ethanol. InChIKey: LSCOQDOWFVSGMZ-UHFFFAOYSA-N.
| Wzór sumaryczny | C16H34O8S2 |
|---|---|
| Masa molowa | 418.6 g/mol |
| Nazwa IUPAC | 2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyldisulfanyl]ethoxy]ethoxy]ethoxy]ethanol |
| InChIKey | LSCOQDOWFVSGMZ-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCSSCCOCCOCCOCCO)O |
Dane obliczone przez PubChem (NCBI)