cas: 2100306-80-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Hydroxy-PEG5-C2-methyl ester (CAS 2100306-80-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg. Oferty producentów: TargetMol.
| producent | TargetMol |
|---|---|
| nr katalogowy | T15535-2mg |
| cas | 2100306-80-5 |
| opakowanie | 2mg |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| TargetMol | 2mg | 412,42 Pln | |
| TargetMol | 5mg | 525,34 Pln | |
| TargetMol | 10mg | 665,09 Pln | |
| TargetMol | 25mg | 950,18 Pln | |
| TargetMol | 50mg | 1315,76 Pln | |
| TargetMol | 100mg | 2019,55 Pln | |
| TargetMol | 500mg | 4589,83 Pln |
| czystość | No data |
|---|---|
| czas dostawy | ok. 26 dni |
Methyl 3-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 2100306-80-5) to związek chemiczny o wzorze sumarycznym C14H28O8 i masie molowej 324.37 g/mol. Nazwa systematyczna IUPAC: methyl 3-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: ZUAYQXPIWZRYOC-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H28O8 |
|---|---|
| Masa molowa | 324.37 g/mol |
| Nazwa IUPAC | methyl 3-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | ZUAYQXPIWZRYOC-UHFFFAOYSA-N |
| SMILES | COC(=O)CCOCCOCCOCCOCCOCCO |
Dane obliczone przez PubChem (NCBI)