cas: 747-36-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Hydroxychloroquine (sulfate), 99.99% (CAS 747-36-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 200 mg, 100 mg, 5 g, 1 g, 10mM/1mL, 10 g, 50 mg, 500 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-B1370-200 mg |
| cas | 747-36-4 |
| opakowanie | 200 mg |
| dostępność | Get quote |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 200 mg | 765,52 Pln | |
| MedChemExpress | 100 mg | 551,89 Pln | |
| MedChemExpress | 5 g | 2585,96 Pln | |
| MedChemExpress | 1 g | 1489,98 Pln | |
| MedChemExpress | 10mM/1mL | 435,79 Pln | |
| MedChemExpress | 10 g | 3324,36 Pln | |
| MedChemExpress | 50 mg | 407,93 Pln | |
| MedChemExpress | 500 mg | 1155,61 Pln |
| czas dostawy | ponad 3 tygodnie |
|---|---|
| czystość | 99.99% |
2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethanol;sulfuric acid (CAS 747-36-4) to związek chemiczny o wzorze sumarycznym C18H28ClN3O5S i masie molowej 434.0 g/mol. Nazwa systematyczna IUPAC: 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethanol;sulfuric acid. InChIKey: JCBIVZZPXRZKTI-UHFFFAOYSA-N.
| Wzór sumaryczny | C18H28ClN3O5S |
|---|---|
| Masa molowa | 434.0 g/mol |
| Nazwa IUPAC | 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethanol;sulfuric acid |
| InChIKey | JCBIVZZPXRZKTI-UHFFFAOYSA-N |
| SMILES | CCN(CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl)CCO.OS(=O)(=O)O |
Dane obliczone przez PubChem (NCBI)