cas: 866028-26-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
INF39, 99.86% (CAS 866028-26-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10 mg, 25 mg, 5 mg, 50 mg, 100 mg, 10mM/1mL. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-101868-10 mg |
| cas | 866028-26-4 |
| opakowanie | 10 mg |
| dostępność | In stock |
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10 mg | 969,85 Pln | |
| MedChemExpress | 25 mg | 1824,35 Pln | |
| MedChemExpress | 5 mg | 677,28 Pln | |
| MedChemExpress | 50 mg | 2678,84 Pln | |
| MedChemExpress | 100 mg | 3955,94 Pln | |
| MedChemExpress | 10mM/1mL | 728,36 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.86% |
Ethyl 2-[(2-chlorophenyl)methyl]prop-2-enoate (CAS 866028-26-4) to związek chemiczny o wzorze sumarycznym C12H13ClO2 i masie molowej 224.68 g/mol. Nazwa systematyczna IUPAC: ethyl 2-[(2-chlorophenyl)methyl]prop-2-enoate. InChIKey: VTAOWWAFBSFWSG-UHFFFAOYSA-N.
| Wzór sumaryczny | C12H13ClO2 |
|---|---|
| Masa molowa | 224.68 g/mol |
| Nazwa IUPAC | ethyl 2-[(2-chlorophenyl)methyl]prop-2-enoate |
| InChIKey | VTAOWWAFBSFWSG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=C)CC1=CC=CC=C1Cl |
Dane obliczone przez PubChem (NCBI)