cas: 2407652-42-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
IRG1-IN-1, 99.82% (CAS 2407652-42-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 25 mg, 10 mg, 50 mg, 10mM/1mL, 5 mg, 100 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-148335-25 mg |
| cas | 2407652-42-8 |
| opakowanie | 25 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 25 mg | 2757,79 Pln | |
| MedChemExpress | 10 mg | 1318,15 Pln | |
| MedChemExpress | 50 mg | 4675,76 Pln | |
| MedChemExpress | 10mM/1mL | 909,48 Pln | |
| MedChemExpress | 5 mg | 839,82 Pln | |
| MedChemExpress | 100 mg | 7318,20 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.82% |
(3Z)-2-benzyl-3-[(4-fluorophenyl)methylidene]butanedioic acid (CAS 2407652-42-8) to związek chemiczny o wzorze sumarycznym C18H15FO4 i masie molowej 314.3 g/mol. Nazwa systematyczna IUPAC: (3Z)-2-benzyl-3-[(4-fluorophenyl)methylidene]butanedioic acid. InChIKey: DZXOXUPVMSOERA-WJDWOHSUSA-N.
| Wzór sumaryczny | C18H15FO4 |
|---|---|
| Masa molowa | 314.3 g/mol |
| Nazwa IUPAC | (3Z)-2-benzyl-3-[(4-fluorophenyl)methylidene]butanedioic acid |
| InChIKey | DZXOXUPVMSOERA-WJDWOHSUSA-N |
| SMILES | C1=CC=C(C=C1)CC(/C(=C/C2=CC=C(C=C2)F)/C(=O)O)C(=O)O |
Dane obliczone przez PubChem (NCBI)