ISO-1, 98%, 98%
cas: 478336-92-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
ISO-1, 98%, 98% (CAS 478336-92-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11DB7E-5mg |
| cas | 478336-92-4 |
| opakowanie | 5mg |
| dostępność | 5g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 5mg | 131,60 Pln | |
| Chemat | 10mg | 146,00 Pln | |
| Chemat | 25mg | 232,40 Pln | |
| Chemat | 50mg | 352,40 Pln | |
| Chemat | 100mg | 554,00 Pln | |
| Chemat | 250mg | 894,80 Pln | |
| Chemat | 1g | 2310,80 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
Methyl 2-[3-(4-hydroxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate (CAS 478336-92-4) to związek chemiczny o wzorze sumarycznym C12H13NO4 i masie molowej 235.24 g/mol. Nazwa systematyczna IUPAC: methyl 2-[3-(4-hydroxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate. InChIKey: AIXMJTYHQHQJLU-UHFFFAOYSA-N.
| Wzór sumaryczny | C12H13NO4 |
|---|---|
| Masa molowa | 235.24 g/mol |
| Nazwa IUPAC | methyl 2-[3-(4-hydroxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]acetate |
| InChIKey | AIXMJTYHQHQJLU-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1CC(=NO1)C2=CC=C(C=C2)O |
Dane obliczone przez PubChem (NCBI)
Synonimy:
3-(4-hydroxyphenyl)-4,5-dihydro-5-isoxazoleacetic acid methyl ester, MIF Antagonist, ISO-1, methyl 2-(3-(4-hydroxyphenyl)-4,5-dihydroisoxazol-5-yl)acetate, 5-Isoxazoleacetic acid, 4,5-dihydro-3-(4-hydroxyphenyl)-, methyl ester, MIF Antagonist, 4,5-dihydro-3-(4-hydroxyphenyl)-5-isoxazoleacetic acid, methyl ester, Methyl 2-[3-(4-Hydroxyphenyl)-4,5-dihydroisoxazol-5-yl]acetate, (S,R)-3-(4-Hydroxyphenyl)-4,5-dihydro-5-isoxazole acetic acid, methyl ester, orb1223117, orb1303909