cas: 353512-04-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
JAK2-IN-6 (CAS 353512-04-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg. Oferty producentów: TargetMol, Chemat.
| producent | TargetMol |
|---|---|
| nr katalogowy | T40443-1mg |
| cas | 353512-04-6 |
| opakowanie | 1mg |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| TargetMol | 1mg | 445,96 Pln | |
| TargetMol | 5mg | 757,88 Pln | |
| TargetMol | 10mg | 1003,28 Pln | |
| TargetMol | 25mg | 1581,29 Pln | |
| TargetMol | 50mg | 2252,09 Pln | |
| TargetMol | 100mg | 3261,64 Pln | |
| TargetMol | 500mg | 6887,32 Pln | |
| Chemat | 500mg | 6184,40 Pln | |
| Chemat | 1mg | 338,00 Pln | |
| Chemat | 5mg | 530,00 Pln | |
| Chemat | 10mg | 822,80 Pln | |
| Chemat | 25mg | 1422,80 Pln | |
| Chemat | 50mg | 2042,00 Pln | |
| Chemat | 100mg | 3030,80 Pln |
| czystość | No data |
|---|---|
| czas dostawy | ok. 15 dni |
(4-amino-2-anilino-1,3-thiazol-5-yl)-(5-chlorothiophen-2-yl)methanone (CAS 353512-04-6) to związek chemiczny o wzorze sumarycznym C14H10ClN3OS2 i masie molowej 335.8 g/mol. Nazwa systematyczna IUPAC: (4-amino-2-anilino-1,3-thiazol-5-yl)-(5-chlorothiophen-2-yl)methanone. InChIKey: OFSYMZBCAABWIK-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H10ClN3OS2 |
|---|---|
| Masa molowa | 335.8 g/mol |
| Nazwa IUPAC | (4-amino-2-anilino-1,3-thiazol-5-yl)-(5-chlorothiophen-2-yl)methanone |
| InChIKey | OFSYMZBCAABWIK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC(=C(S2)C(=O)C3=CC=C(S3)Cl)N |
Dane obliczone przez PubChem (NCBI)