cas: 681136-29-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
JNJ-1661010, 99.77% (CAS 681136-29-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10 mg, 5 mg, 10mM/1mL, 25 mg, 50 mg, 100 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-N7062-10 mg |
| cas | 681136-29-8 |
| opakowanie | 10 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10 mg | 528,67 Pln | |
| MedChemExpress | 5 mg | 361,49 Pln | |
| MedChemExpress | 10mM/1mL | 384,71 Pln | |
| MedChemExpress | 25 mg | 960,56 Pln | |
| MedChemExpress | 50 mg | 1462,12 Pln | |
| MedChemExpress | 100 mg | 2279,46 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.77% |
N-phenyl-4-(3-phenyl-1,2,4-thiadiazol-5-yl)piperazine-1-carboxamide (CAS 681136-29-8) to związek chemiczny o wzorze sumarycznym C19H19N5OS i masie molowej 365.5 g/mol. Nazwa systematyczna IUPAC: N-phenyl-4-(3-phenyl-1,2,4-thiadiazol-5-yl)piperazine-1-carboxamide. InChIKey: BHBOSTKQCZEAJM-UHFFFAOYSA-N.
| Wzór sumaryczny | C19H19N5OS |
|---|---|
| Masa molowa | 365.5 g/mol |
| Nazwa IUPAC | N-phenyl-4-(3-phenyl-1,2,4-thiadiazol-5-yl)piperazine-1-carboxamide |
| InChIKey | BHBOSTKQCZEAJM-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=NC(=NS2)C3=CC=CC=C3)C(=O)NC4=CC=CC=C4 |
Dane obliczone przez PubChem (NCBI)