cas: 1146594-87-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
JNJ-40418677, 99.48% (CAS 1146594-87-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10mM/1mL, 5 mg, 50 mg, 1 mg, 10 mg, 25 mg, 100 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-100604-10mM/1mL |
| cas | 1146594-87-7 |
| opakowanie | 10mM/1mL |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 881,62 Pln | |
| MedChemExpress | 5 mg | 839,82 Pln | |
| MedChemExpress | 50 mg | 4438,92 Pln | |
| MedChemExpress | 1 mg | 310,40 Pln | |
| MedChemExpress | 10 mg | 1271,71 Pln | |
| MedChemExpress | 25 mg | 2664,91 Pln | |
| MedChemExpress | 100 mg | 7462,16 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 99.48% |
(2S)-2-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid (CAS 1146594-87-7) to związek chemiczny o wzorze sumarycznym C26H22F6O2 i masie molowej 480.4 g/mol. Nazwa systematyczna IUPAC: (2S)-2-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid. InChIKey: RQOWDDLKGBMJFX-QHCPKHFHSA-N.
| Wzór sumaryczny | C26H22F6O2 |
|---|---|
| Masa molowa | 480.4 g/mol |
| Nazwa IUPAC | (2S)-2-[3,5-bis[4-(trifluoromethyl)phenyl]phenyl]-4-methylpentanoic acid |
| InChIKey | RQOWDDLKGBMJFX-QHCPKHFHSA-N |
| SMILES | CC(C)C[C@@H](C1=CC(=CC(=C1)C2=CC=C(C=C2)C(F)(F)F)C3=CC=C(C=C3)C(F)(F)F)C(=O)O |
Dane obliczone przez PubChem (NCBI)