cas: 1802326-66-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
JNJ-63533054, 99.80% (CAS 1802326-66-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50 mg, 100 mg, 25 mg, 10 mg, 10mM/1mL, 5 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-19838-50 mg |
| cas | 1802326-66-4 |
| opakowanie | 50 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 50 mg | 1810,42 Pln | |
| MedChemExpress | 100 mg | 2832,10 Pln | |
| MedChemExpress | 25 mg | 1174,19 Pln | |
| MedChemExpress | 10 mg | 649,42 Pln | |
| MedChemExpress | 10mM/1mL | 533,32 Pln | |
| MedChemExpress | 5 mg | 496,16 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.80% |
3-chloro-N-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl]benzamide (CAS 1802326-66-4) to związek chemiczny o wzorze sumarycznym C17H17ClN2O2 i masie molowej 316.8 g/mol. Nazwa systematyczna IUPAC: 3-chloro-N-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl]benzamide. InChIKey: MWDVCHRYCKXEBY-LBPRGKRZSA-N.
| Wzór sumaryczny | C17H17ClN2O2 |
|---|---|
| Masa molowa | 316.8 g/mol |
| Nazwa IUPAC | 3-chloro-N-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl]benzamide |
| InChIKey | MWDVCHRYCKXEBY-LBPRGKRZSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)NC(=O)CNC(=O)C2=CC(=CC=C2)Cl |
Dane obliczone przez PubChem (NCBI)