cas: 401907-26-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
JYL 1421, 99.54% (CAS 401907-26-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10 mg, 25 mg, 100 mg, 5 mg, 50 mg, 10mM/1mL. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-100668-10 mg |
| cas | 401907-26-4 |
| opakowanie | 10 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10 mg | 1991,53 Pln | |
| MedChemExpress | 25 mg | 3863,06 Pln | |
| MedChemExpress | 100 mg | 9236,17 Pln | |
| MedChemExpress | 5 mg | 1271,71 Pln | |
| MedChemExpress | 50 mg | 6115,40 Pln | |
| MedChemExpress | 10mM/1mL | 1192,76 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.54% |
1-[(4-tert-butylphenyl)methyl]-3-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]thiourea (CAS 401907-26-4) to związek chemiczny o wzorze sumarycznym C20H26FN3O2S2 i masie molowej 423.6 g/mol. Nazwa systematyczna IUPAC: 1-[(4-tert-butylphenyl)methyl]-3-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]thiourea. InChIKey: DUHBVFMCIJLUJX-UHFFFAOYSA-N.
| Wzór sumaryczny | C20H26FN3O2S2 |
|---|---|
| Masa molowa | 423.6 g/mol |
| Nazwa IUPAC | 1-[(4-tert-butylphenyl)methyl]-3-[[3-fluoro-4-(methanesulfonamido)phenyl]methyl]thiourea |
| InChIKey | DUHBVFMCIJLUJX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)CNC(=S)NCC2=CC(=C(C=C2)NS(=O)(=O)C)F |
Dane obliczone przez PubChem (NCBI)