cas: 1135280-28-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
KN-92 (phosphate), 99.68% (CAS 1135280-28-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 25 mg, 50 mg, 10mM/1mL, 1 mg, 10 mg, 100 mg, 5 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-15517A-25 mg |
| cas | 1135280-28-2 |
| opakowanie | 25 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 25 mg | 1894,01 Pln | |
| MedChemExpress | 50 mg | 2757,79 Pln | |
| MedChemExpress | 10mM/1mL | 881,62 Pln | |
| MedChemExpress | 1 mg | 310,40 Pln | |
| MedChemExpress | 10 mg | 1174,19 Pln | |
| MedChemExpress | 100 mg | 3863,06 Pln | |
| MedChemExpress | 5 mg | 742,30 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 99.68% |
N-[2-[[[(E)-3-(4-chlorophenyl)prop-2-enyl]-methylamino]methyl]phenyl]-4-methoxybenzenesulfonamide;phosphoric acid (CAS 1135280-28-2) to związek chemiczny o wzorze sumarycznym C24H28ClN2O7PS i masie molowej 555.0 g/mol. Nazwa systematyczna IUPAC: N-[2-[[[(E)-3-(4-chlorophenyl)prop-2-enyl]-methylamino]methyl]phenyl]-4-methoxybenzenesulfonamide;phosphoric acid. InChIKey: XRQHWVVDNMJDEQ-IPZCTEOASA-N.
| Wzór sumaryczny | C24H28ClN2O7PS |
|---|---|
| Masa molowa | 555.0 g/mol |
| Nazwa IUPAC | N-[2-[[[(E)-3-(4-chlorophenyl)prop-2-enyl]-methylamino]methyl]phenyl]-4-methoxybenzenesulfonamide;phosphoric acid |
| InChIKey | XRQHWVVDNMJDEQ-IPZCTEOASA-N |
| SMILES | CN(C/C=C/C1=CC=C(C=C1)Cl)CC2=CC=CC=C2NS(=O)(=O)C3=CC=C(C=C3)OC.OP(=O)(O)O |
Dane obliczone przez PubChem (NCBI)