cas: 2274819-46-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
LUT014, 97.09% (CAS 2274819-46-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100 mg, 10 mg, 25 mg, 10mM/1mL, 50 mg, 5 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-111940-100 mg |
| cas | 2274819-46-2 |
| opakowanie | 100 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 100 mg | 4285,67 Pln | |
| MedChemExpress | 10 mg | 1308,86 Pln | |
| MedChemExpress | 25 mg | 2242,31 Pln | |
| MedChemExpress | 10mM/1mL | 1109,17 Pln | |
| MedChemExpress | 50 mg | 3096,80 Pln | |
| MedChemExpress | 5 mg | 969,85 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 97.09% |
6-methyl-5-N-[3-(7H-purin-6-yl)-2-pyridinyl]-1-N-[3-(trifluoromethoxy)phenyl]isoquinoline-1,5-diamine (CAS 2274819-46-2) to związek chemiczny o wzorze sumarycznym C27H19F3N8O i masie molowej 528.5 g/mol. Nazwa systematyczna IUPAC: 6-methyl-5-N-[3-(7H-purin-6-yl)-2-pyridinyl]-1-N-[3-(trifluoromethoxy)phenyl]isoquinoline-1,5-diamine. InChIKey: FZPYULHBUBXPIG-UHFFFAOYSA-N.
| Wzór sumaryczny | C27H19F3N8O |
|---|---|
| Masa molowa | 528.5 g/mol |
| Nazwa IUPAC | 6-methyl-5-N-[3-(7H-purin-6-yl)-2-pyridinyl]-1-N-[3-(trifluoromethoxy)phenyl]isoquinoline-1,5-diamine |
| InChIKey | FZPYULHBUBXPIG-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=NC=C2)NC3=CC(=CC=C3)OC(F)(F)F)NC4=C(C=CC=N4)C5=C6C(=NC=N5)N=CN6 |
Dane obliczone przez PubChem (NCBI)