cas: 1423018-12-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
LY2922470 (CAS 1423018-12-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 25mg, 50mg, 100mg, 1mg, 5mg, 10mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch12R8TT-25mg |
| cas | 1423018-12-5 |
| opakowanie | 25mg |
| dostępność | 0.1g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 25mg | 4134,80 Pln | |
| Chemat | 50mg | 5694,80 Pln | |
| Chemat | 100mg | 7566,80 Pln | |
| Chemat | 1mg | 707,60 Pln | |
| Chemat | 5mg | 1763,60 Pln | |
| Chemat | 10mg | 2661,20 Pln |
| czas dostawy | 3 tygodnie |
|---|
(3S)-3-[4-[[5-[(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)methyl]thiophen-2-yl]methoxy]phenyl]hex-4-ynoic acid (CAS 1423018-12-5) to związek chemiczny o wzorze sumarycznym C28H29NO4S i masie molowej 475.6 g/mol. Nazwa systematyczna IUPAC: (3S)-3-[4-[[5-[(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)methyl]thiophen-2-yl]methoxy]phenyl]hex-4-ynoic acid. InChIKey: VJVDLRVFJTVWEO-QFIPXVFZSA-N.
| Wzór sumaryczny | C28H29NO4S |
|---|---|
| Masa molowa | 475.6 g/mol |
| Nazwa IUPAC | (3S)-3-[4-[[5-[(8-methoxy-3,4-dihydro-2H-quinolin-1-yl)methyl]thiophen-2-yl]methoxy]phenyl]hex-4-ynoic acid |
| InChIKey | VJVDLRVFJTVWEO-QFIPXVFZSA-N |
| SMILES | CC#C[C@@H](CC(=O)O)C1=CC=C(C=C1)OCC2=CC=C(S2)CN3CCCC4=C3C(=CC=C4)OC |
Dane obliczone przez PubChem (NCBI)