cas: 73466-12-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Leukotriene A4 methyl ester (CAS 73466-12-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 25ug, 50ug, 100ug, 25μg, 50μg, 100μg, 50 μg (300.77 μM * 500 μL in Hexane containing 1% triethylamine), 25 μg (300.77 μM * 250 μL in Hexane containing 1% triethylamine). Oferty producentów: TargetMol, GLPBio, Sigma-Aldrich, MedChemExpress.
| producent | TargetMol |
|---|---|
| nr katalogowy | T37616-25ug |
| cas | 73466-12-3 |
| opakowanie | 25ug |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| TargetMol | 25ug | 2471,22 Pln | |
| TargetMol | 50ug | 4516,60 Pln | |
| TargetMol | 100ug | 8335,13 Pln | |
| GLPBio | 25μg | 1359,96 Pln | |
| GLPBio | 50μg | 2211,81 Pln | |
| GLPBio | 100μg | 3817,22 Pln | |
| Sigma-Aldrich | 100UG | 1770,00 Pln | |
| MedChemExpress | 50 μg (300.77 μM * 500 μL in Hexane containing 1% triethylamine) | 3013,21 Pln | |
| MedChemExpress | 25 μg (300.77 μM * 250 μL in Hexane containing 1% triethylamine) | 1703,60 Pln |
| czystość | No data |
|---|---|
| czas dostawy | na zapytanie |
Methyl 4-[(2S,3S)-3-[(1E,3E,5Z,8Z)-tetradeca-1,3,5,8-tetraenyl]oxiran-2-yl]butanoate (CAS 73466-12-3) to związek chemiczny o wzorze sumarycznym C21H32O3 i masie molowej 332.5 g/mol. Nazwa systematyczna IUPAC: methyl 4-[(2S,3S)-3-[(1E,3E,5Z,8Z)-tetradeca-1,3,5,8-tetraenyl]oxiran-2-yl]butanoate. InChIKey: WTKAVFHPLJFCMZ-NIBLXIPLSA-N.
| Wzór sumaryczny | C21H32O3 |
|---|---|
| Masa molowa | 332.5 g/mol |
| Nazwa IUPAC | methyl 4-[(2S,3S)-3-[(1E,3E,5Z,8Z)-tetradeca-1,3,5,8-tetraenyl]oxiran-2-yl]butanoate |
| InChIKey | WTKAVFHPLJFCMZ-NIBLXIPLSA-N |
| SMILES | CCCCC/C=C\C/C=C\C=C\C=C\[C@H]1[C@@H](O1)CCCC(=O)OC |
Dane obliczone przez PubChem (NCBI)