cas: 121288-39-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Loxoribine, 99.94% (CAS 121288-39-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100 mg, 10mM/1mL, 10 mg, 25 mg, 50 mg, 5 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-108472-100 mg |
| cas | 121288-39-9 |
| opakowanie | 100 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 100 mg | 1485,34 Pln | |
| MedChemExpress | 10mM/1mL | 328,98 Pln | |
| MedChemExpress | 10 mg | 431,15 Pln | |
| MedChemExpress | 25 mg | 719,08 Pln | |
| MedChemExpress | 50 mg | 1030,22 Pln | |
| MedChemExpress | 5 mg | 310,40 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 99.94% |
2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-enyl-1H-purine-6,8-dione (CAS 121288-39-9) to związek chemiczny o wzorze sumarycznym C13H17N5O6 i masie molowej 339.30 g/mol. Nazwa systematyczna IUPAC: 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-enyl-1H-purine-6,8-dione. InChIKey: VDCRFBBZFHHYGT-IOSLPCCCSA-N.
| Wzór sumaryczny | C13H17N5O6 |
|---|---|
| Masa molowa | 339.30 g/mol |
| Nazwa IUPAC | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-enyl-1H-purine-6,8-dione |
| InChIKey | VDCRFBBZFHHYGT-IOSLPCCCSA-N |
| SMILES | C=CCN1C2=C(N=C(NC2=O)N)N(C1=O)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O |
Dane obliczone przez PubChem (NCBI)