cas: 521-31-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Luminol, 99.95% (CAS 521-31-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50 g, 5 g, 1 g, 10 g, 100 g, 10mM/1mL, 500 mg, 25 g. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-15922-50 g |
| cas | 521-31-3 |
| opakowanie | 50 g |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 50 g | 1369,24 Pln | |
| MedChemExpress | 5 g | 486,88 Pln | |
| MedChemExpress | 1 g | 333,62 Pln | |
| MedChemExpress | 10 g | 635,48 Pln | |
| MedChemExpress | 100 g | 1870,79 Pln | |
| MedChemExpress | 10mM/1mL | 277,90 Pln | |
| MedChemExpress | 500 mg | 263,96 Pln | |
| MedChemExpress | 25 g | 941,99 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 99.95% |
5-amino-2,3-dihydrophthalazine-1,4-dione (CAS 521-31-3) to związek chemiczny o wzorze sumarycznym C8H7N3O2 i masie molowej 177.16 g/mol. Nazwa systematyczna IUPAC: 5-amino-2,3-dihydrophthalazine-1,4-dione. InChIKey: HWYHZTIRURJOHG-UHFFFAOYSA-N.
| Wzór sumaryczny | C8H7N3O2 |
|---|---|
| Masa molowa | 177.16 g/mol |
| Nazwa IUPAC | 5-amino-2,3-dihydrophthalazine-1,4-dione |
| InChIKey | HWYHZTIRURJOHG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)N)C(=O)NNC2=O |
Dane obliczone przez PubChem (NCBI)