cas: 1811510-58-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
MAP4K4-IN-3, 99.15% (CAS 1811510-58-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 200 mg, 10mM/1mL, 5 mg, 25 mg, 100 mg, 10 mg, 500 mg, 50 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-125012-200 mg |
| cas | 1811510-58-3 |
| opakowanie | 200 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 200 mg | 3431,17 Pln | |
| MedChemExpress | 10mM/1mL | 384,71 Pln | |
| MedChemExpress | 5 mg | 361,49 Pln | |
| MedChemExpress | 25 mg | 1030,22 Pln | |
| MedChemExpress | 100 mg | 2423,42 Pln | |
| MedChemExpress | 10 mg | 551,89 Pln | |
| MedChemExpress | 500 mg | 5158,74 Pln | |
| MedChemExpress | 50 mg | 1559,64 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 99.15% |
5-[6-amino-5-(4-chlorophenyl)-3-pyridinyl]pyrimidin-2-amine (CAS 1811510-58-3) to związek chemiczny o wzorze sumarycznym C15H12ClN5 i masie molowej 297.74 g/mol. Nazwa systematyczna IUPAC: 5-[6-amino-5-(4-chlorophenyl)-3-pyridinyl]pyrimidin-2-amine. InChIKey: KSQDIECZAQKQQW-UHFFFAOYSA-N.
| Wzór sumaryczny | C15H12ClN5 |
|---|---|
| Masa molowa | 297.74 g/mol |
| Nazwa IUPAC | 5-[6-amino-5-(4-chlorophenyl)-3-pyridinyl]pyrimidin-2-amine |
| InChIKey | KSQDIECZAQKQQW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(N=CC(=C2)C3=CN=C(N=C3)N)N)Cl |
Dane obliczone przez PubChem (NCBI)