cas: 1062271-24-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
MK6-83, 98.27% (CAS 1062271-24-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 25 mg, 50 mg, 100 mg, 5 mg, 10mM/1mL, 10 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-110238-25 mg |
| cas | 1062271-24-2 |
| opakowanie | 25 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 25 mg | 1308,86 Pln | |
| MedChemExpress | 50 mg | 2126,21 Pln | |
| MedChemExpress | 100 mg | 3551,92 Pln | |
| MedChemExpress | 5 mg | 519,38 Pln | |
| MedChemExpress | 10mM/1mL | 556,54 Pln | |
| MedChemExpress | 10 mg | 700,50 Pln |
| czas dostawy | 1-2 tygodnie |
|---|---|
| czystość | 98.27% |
5-methyl-N-(2-piperidin-1-ylphenyl)thiophene-2-sulfonamide (CAS 1062271-24-2) to związek chemiczny o wzorze sumarycznym C16H20N2O2S2 i masie molowej 336.5 g/mol. Nazwa systematyczna IUPAC: 5-methyl-N-(2-piperidin-1-ylphenyl)thiophene-2-sulfonamide. InChIKey: IRGYSXZCDAWOOC-UHFFFAOYSA-N.
| Wzór sumaryczny | C16H20N2O2S2 |
|---|---|
| Masa molowa | 336.5 g/mol |
| Nazwa IUPAC | 5-methyl-N-(2-piperidin-1-ylphenyl)thiophene-2-sulfonamide |
| InChIKey | IRGYSXZCDAWOOC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(S1)S(=O)(=O)NC2=CC=CC=C2N3CCCCC3 |
Dane obliczone przez PubChem (NCBI)