Maropitant, 98%, 98%
cas: 147116-67-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Maropitant, 98%, 98% (CAS 147116-67-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50mg, 100mg, 250mg, 1g, 5g, 5mg, 10mg, 25mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch112ELW-50mg |
| cas | 147116-67-4 |
| opakowanie | 50mg |
| dostępność | 25g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 50mg | 102,80 Pln | |
| Chemat | 100mg | 112,40 Pln | |
| Chemat | 250mg | 126,80 Pln | |
| Chemat | 1g | 232,40 Pln | |
| Chemat | 5g | 650,00 Pln | |
| Chemat | 5mg | 78,80 Pln | |
| Chemat | 10mg | 83,60 Pln | |
| Chemat | 25mg | 88,40 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
(2S,3S)-2-benzhydryl-N-[(5-tert-butyl-2-methoxyphenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine (CAS 147116-67-4) to związek chemiczny o wzorze sumarycznym C32H40N2O i masie molowej 468.7 g/mol. Nazwa systematyczna IUPAC: (2S,3S)-2-benzhydryl-N-[(5-tert-butyl-2-methoxyphenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine. InChIKey: OMPCVMLFFSQFIX-CONSDPRKSA-N.
| Wzór sumaryczny | C32H40N2O |
|---|---|
| Masa molowa | 468.7 g/mol |
| Nazwa IUPAC | (2S,3S)-2-benzhydryl-N-[(5-tert-butyl-2-methoxyphenyl)methyl]-1-azabicyclo[2.2.2]octan-3-amine |
| InChIKey | OMPCVMLFFSQFIX-CONSDPRKSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)OC)CN[C@@H]2[C@@H](N3CCC2CC3)C(C4=CC=CC=C4)C5=CC=CC=C5 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
maropitant, Cerenia Tablets, maropitantum, Cerenia Injectable Solution, Maropitant [INN], (2S,3S)-2-Benzhydryl-N-(5-(tert-butyl)-2-methoxybenzyl)quinuclidin-3-amine, (2S,3S)-2-Benzhydryl-N-(5-tert-butyl-2-methoxybenzyl) quinuclidin-3-amine, (2S,3S)-2-Benzhydryl-N-[5-(tert-butyl)-2-methoxybenzyl]quinuclidin-3-amine, MAROPITANT [MI], (2s,3s)-2-benzhydryl-n-(5-tert-butyl-2-methoxybenzyl)quinuclidin-3-amine