cas: 103909-75-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Maxacalcitol (CAS 103909-75-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: on request, 1mg, 5mg, 10mg, 25mg, 50mg. Oferty producentów: Chemat Brand, TargetMol, GLPBio.
| producent | Chemat Brand |
|---|---|
| nr katalogowy | ULM113001 |
| cas | 103909-75-7 |
| opakowanie | on request |
| dostępność | Do potwierdzenia przez Chemat|To be confirmed by Chemat |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat Brand | on request | cena na żądanie | |
| TargetMol | 1mg | 810,99 Pln | |
| TargetMol | 5mg | 2484,63 Pln | |
| TargetMol | 10mg | 3746,30 Pln | |
| TargetMol | 25mg | 7265,76 Pln | |
| TargetMol | 50mg | 11489,56 Pln | |
| GLPBio | 1mg | 919,99 Pln | |
| GLPBio | 5mg | 2057,36 Pln |
| czystość | No data |
|---|---|
| kategoria | Chemicals |
| czas dostawy | Do potwierdzenia przez Chemat |
Trans-(1R,3S,5Z)-5-[(2E)-2-[(1S,3aS,7aS)-1-[(1S)-1-(3-hydroxy-3-methylbutoxy)ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol (CAS 103909-75-7) to związek chemiczny o wzorze sumarycznym C26H42O4 i masie molowej 418.6 g/mol. Nazwa systematyczna IUPAC: trans-(1R,3S,5Z)-5-[(2E)-2-[(1S,3aS,7aS)-1-[(1S)-1-(3-hydroxy-3-methylbutoxy)ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol. InChIKey: DTXXSJZBSTYZKE-ZDQKKZTESA-N.
| Wzór sumaryczny | C26H42O4 |
|---|---|
| Masa molowa | 418.6 g/mol |
| Nazwa IUPAC | trans-(1R,3S,5Z)-5-[(2E)-2-[(1S,3aS,7aS)-1-[(1S)-1-(3-hydroxy-3-methylbutoxy)ethyl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| InChIKey | DTXXSJZBSTYZKE-ZDQKKZTESA-N |
| SMILES | C[C@@H]([C@H]1CC[C@@H]\2[C@@]1(CCC/C2=C\C=C/3\C[C@H](C[C@@H](C3=C)O)O)C)OCCC(C)(C)O |
Dane obliczone przez PubChem (NCBI)