cas: 863-61-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Menaquinone-4, 99.96% (CAS 863-61-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 10mM/1mL, 100 mg, 500 mg, 25 g, 250 mg, 50 g, 5 g, 1 g. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-B2156-10mM/1mL |
| cas | 863-61-6 |
| opakowanie | 10mM/1mL |
| dostępność | Get quote |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 328,98 Pln | |
| MedChemExpress | 100 mg | 310,40 Pln | |
| MedChemExpress | 500 mg | 733,01 Pln | |
| MedChemExpress | 25 g | 4531,80 Pln | |
| MedChemExpress | 250 mg | 505,45 Pln | |
| MedChemExpress | 50 g | 6301,16 Pln | |
| MedChemExpress | 5 g | 2089,06 Pln | |
| MedChemExpress | 1 g | 1104,53 Pln | |
| MedChemExpress | 10 g | 2873,89 Pln |
| czas dostawy | ponad 3 tygodnie |
|---|---|
| czystość | 99.96% |
2-methyl-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]naphthalene-1,4-dione (CAS 863-61-6) to związek chemiczny o wzorze sumarycznym C31H40O2 i masie molowej 444.6 g/mol. Nazwa systematyczna IUPAC: 2-methyl-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]naphthalene-1,4-dione. InChIKey: DKHGMERMDICWDU-GHDNBGIDSA-N.
| Wzór sumaryczny | C31H40O2 |
|---|---|
| Masa molowa | 444.6 g/mol |
| Nazwa IUPAC | 2-methyl-3-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]naphthalene-1,4-dione |
| InChIKey | DKHGMERMDICWDU-GHDNBGIDSA-N |
| SMILES | CC1=C(C(=O)C2=CC=CC=C2C1=O)C/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CCC=C(C)C |
Dane obliczone przez PubChem (NCBI)