Mesityl(phenyl)methanone, 98%, 98%
cas: 954-16-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Mesityl(phenyl)methanone, 98%, 98% (CAS 954-16-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 75g, 200g, 300g, 50g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch1171DT-75g |
| cas | 954-16-5 |
| opakowanie | 75g |
| dostępność | 10000g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 75g | 146,00 Pln | |
| Chemat | 200g | 237,20 Pln | |
| Chemat | 300g | 318,80 Pln | |
| Chemat | 50g | 117,20 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
Phenyl-(2,4,6-trimethylphenyl)methanone (CAS 954-16-5) to związek chemiczny o wzorze sumarycznym C16H16O i masie molowej 224.30 g/mol. Nazwa systematyczna IUPAC: phenyl-(2,4,6-trimethylphenyl)methanone. InChIKey: HPAFOABSQZMTHE-UHFFFAOYSA-N.
| Wzór sumaryczny | C16H16O |
|---|---|
| Masa molowa | 224.30 g/mol |
| Nazwa IUPAC | phenyl-(2,4,6-trimethylphenyl)methanone |
| InChIKey | HPAFOABSQZMTHE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(=O)C2=CC=CC=C2)C |
Dane obliczone przez PubChem (NCBI)
Synonimy:
2,4,6-Trimethylbenzophenone, Methanone, phenyl(2,4,6-trimethylphenyl)-, Ketone, mesityl phenyl, Benzophenone, 2,4,6-trimethyl-, Mesitylene, 2-benzoyl-, 2,4,6-Trimetilbenzofenon, HPAFOABSQZMTHE-UHFFFAOYSA-N, Mesityl(phenyl)methanone, Mesityl phenyl ketone, phenyl-(2,4,6-trimethylphenyl)methanone