cas: 298-81-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Methoxsalen, 99.98% (CAS 298-81-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 50 g, 25 g, 500 mg, 10mM/1mL, 5 g, 1 g, 10 g. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-30151-50 g |
| cas | 298-81-7 |
| opakowanie | 50 g |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 50 g | 2469,86 Pln | |
| MedChemExpress | 25 g | 1801,13 Pln | |
| MedChemExpress | 500 mg | 384,71 Pln | |
| MedChemExpress | 10mM/1mL | 412,57 Pln | |
| MedChemExpress | 5 g | 765,52 Pln | |
| MedChemExpress | 1 g | 500,81 Pln | |
| MedChemExpress | 10 g | 1174,19 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 99.98% |
9-methoxyfuro[3,2-g]chromen-7-one (CAS 298-81-7) to związek chemiczny o wzorze sumarycznym C12H8O4 i masie molowej 216.19 g/mol. Nazwa systematyczna IUPAC: 9-methoxyfuro[3,2-g]chromen-7-one. InChIKey: QXKHYNVANLEOEG-UHFFFAOYSA-N.
| Wzór sumaryczny | C12H8O4 |
|---|---|
| Masa molowa | 216.19 g/mol |
| Nazwa IUPAC | 9-methoxyfuro[3,2-g]chromen-7-one |
| InChIKey | QXKHYNVANLEOEG-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=CC3=C1OC=C3)C=CC(=O)O2 |
Dane obliczone przez PubChem (NCBI)