Methyl (S)-3-amino-3-(3-(trifluoromethyl)phenyl)propanoate hydrochloride, 95%
cas: 1354970-79-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Methyl (S)-3-amino-3-(3-(trifluoromethyl)phenyl)propanoate hydrochloride, 95% (CAS 1354970-79-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 50mg. Oferty producentów: Ambeed, Chemat, BLDpharm.
| producent | Ambeed |
|---|---|
| nr katalogowy | A804008-100mg |
| cas | 1354970-79-8 |
| opakowanie | 100mg |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Ambeed | 100mg | 498,31 Pln | |
| Ambeed | 250mg | 1071,25 Pln | |
| Ambeed | 1g | 2929,12 Pln | |
| Ambeed | 5g | 8091,12 Pln | |
| Chemat | 50mg | 357,20 Pln | |
| Chemat | 100mg | 558,80 Pln | |
| Chemat | 250mg | 976,40 Pln | |
| Chemat | 1g | 2507,60 Pln | |
| Chemat | 5g | 9578,00 Pln | |
| BLDpharm | 50mg | 453,20 Pln | |
| BLDpharm | 100mg | 530,95 Pln | |
| BLDpharm | 250mg | 1147,40 Pln | |
| BLDpharm | 1g | 3152,25 Pln | |
| BLDpharm | 5g | 8722,51 Pln |
właściwości
| czystość | 95% |
|---|---|
| czas dostawy | 2-3 tygodnie |
Methyl (3S)-3-amino-3-[3-(trifluoromethyl)phenyl]propanoate;hydrochloride (CAS 1354970-79-8) to związek chemiczny o wzorze sumarycznym C11H13ClF3NO2 i masie molowej 283.67 g/mol. Nazwa systematyczna IUPAC: methyl (3S)-3-amino-3-[3-(trifluoromethyl)phenyl]propanoate;hydrochloride. InChIKey: DGWMURZHACRUMX-FVGYRXGTSA-N.
| Wzór sumaryczny | C11H13ClF3NO2 |
|---|---|
| Masa molowa | 283.67 g/mol |
| Nazwa IUPAC | methyl (3S)-3-amino-3-[3-(trifluoromethyl)phenyl]propanoate;hydrochloride |
| InChIKey | DGWMURZHACRUMX-FVGYRXGTSA-N |
| SMILES | COC(=O)C[C@@H](C1=CC(=CC=C1)C(F)(F)F)N.Cl |
Dane obliczone przez PubChem (NCBI)
Synonimy:
methyl (3S)-3-amino-3-[3-(trifluoromethyl)phenyl]propanoate hydrochloride, methyl (3S)-3-amino-3-(3-(trifluoromethyl)phenyl)propanoate hydrochloride, Methyl (S)-3-amino-3-(3-(trifluoromethyl)phenyl)propanoate hydrochloride, methyl (3S)-3-amino-3-[3-(trifluoromethyl)phenyl]propanoate;hydrochloride, methyl (3S)-3-azanyl-3-[3-(trifluoromethyl)phenyl]propanoate;hydrochloride