Methyl 1-Boc-4-methylpiperidine-4-carboxylate, 98%, 98%
cas: 724790-59-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Methyl 1-Boc-4-methylpiperidine-4-carboxylate, 98%, 98% (CAS 724790-59-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g, 25g, 100g, 100mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch114RK4-250mg |
| cas | 724790-59-4 |
| opakowanie | 250mg |
| dostępność | 300g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 131,60 Pln | |
| Chemat | 1g | 198,80 Pln | |
| Chemat | 5g | 357,20 Pln | |
| Chemat | 10g | 568,40 Pln | |
| Chemat | 25g | 942,80 Pln | |
| Chemat | 100g | 2594,00 Pln | |
| Chemat | 100mg | 107,60 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
1-O-tert-butyl 4-O-methyl 4-methylpiperidine-1,4-dicarboxylate (CAS 724790-59-4) to związek chemiczny o wzorze sumarycznym C13H23NO4 i masie molowej 257.33 g/mol. Nazwa systematyczna IUPAC: 1-O-tert-butyl 4-O-methyl 4-methylpiperidine-1,4-dicarboxylate. InChIKey: SNBGURLVYHVYEB-UHFFFAOYSA-N.
| Wzór sumaryczny | C13H23NO4 |
|---|---|
| Masa molowa | 257.33 g/mol |
| Nazwa IUPAC | 1-O-tert-butyl 4-O-methyl 4-methylpiperidine-1,4-dicarboxylate |
| InChIKey | SNBGURLVYHVYEB-UHFFFAOYSA-N |
| SMILES | CC1(CCN(CC1)C(=O)OC(C)(C)C)C(=O)OC |
Dane obliczone przez PubChem (NCBI)
Synonimy:
1-tert-Butyl 4-methyl 4-methylpiperidine-1,4-dicarboxylate, 1-O-tert-butyl 4-O-methyl 4-methylpiperidine-1,4-dicarboxylate, SNBGURLVYHVYEB-UHFFFAOYSA-N, 1-(tert-butyl) 4-methyl 4-methylpiperidine-1,4-dicarboxylate, O1-tert-butyl O4-methyl 4-methylpiperidine-1,4-dicarboxylate, 1-(1,1-dimethylethyl) 4-methyl 4-methyl-1,4-piperidinedicarboxylate, 4-methyl-piperidine-1,4-dicarboxylic acid 1-tert-butyl ester 4-methyl ester, 4-Methylpiperidine-1,4-dicarboxylic acid 1-tert-butyl ester 4-methyl ester