Methyl 2-Bromo-3-methylbenzoate, 98%, 98%
cas: 131001-86-0 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Methyl 2-Bromo-3-methylbenzoate, 98%, 98% (CAS 131001-86-0) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 5g, 10g, 25g, 100g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch111VBO-1g |
| cas | 131001-86-0 |
| opakowanie | 1g |
| dostępność | 279.11g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1g | 74,00 Pln | |
| Chemat | 5g | 78,80 Pln | |
| Chemat | 10g | 93,20 Pln | |
| Chemat | 25g | 136,40 Pln | |
| Chemat | 100g | 362,00 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
Methyl 2-bromo-3-methylbenzoate (CAS 131001-86-0) to związek chemiczny o wzorze sumarycznym C9H9BrO2 i masie molowej 229.07 g/mol. Nazwa systematyczna IUPAC: methyl 2-bromo-3-methylbenzoate. InChIKey: QAOFGUXVDAZKBW-UHFFFAOYSA-N.
| Wzór sumaryczny | C9H9BrO2 |
|---|---|
| Masa molowa | 229.07 g/mol |
| Nazwa IUPAC | methyl 2-bromo-3-methylbenzoate |
| InChIKey | QAOFGUXVDAZKBW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(=O)OC)Br |
Dane obliczone przez PubChem (NCBI)
Synonimy:
Methyl 2-bromo-3-methylbenzoate, 2-Bromo-3-methyl-benzoic acid methyl ester, 2-Bromo-3-methylbenzoic acid methyl ester, Methyl 2-bromo-3-methyl-benzoate, Methyl2-bromo-3-methylbenzoate, 3-methyl-2-bromobenzoic acid methyl ester, Methyl 2-Bromo-m-toluate, Methyl 2-bromo-methyl-benzoate, QAOFGUXVDAZKBW-UHFFFAOYSA-N, 2-Bromo-m-toluic Acid Methyl Ester