Methyl 2-amino-4-nitrobenzoate, 98%
cas: 3558-19-8 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Methyl 2-amino-4-nitrobenzoate, 98% (CAS 3558-19-8) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 5g, 1g, 10g, 25g, 250mg, 100mg. Oferty producentów: Combi-blocks, Ambeed, BLDpharm, Chemat.
| producent | Combi-blocks |
|---|---|
| nr katalogowy | YC-0854-5g |
| cas | 3558-19-8 |
| opakowanie | 5g |
Dokumenty:
Karta charakterystyki (MSDS)
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Combi-blocks | 5g | cena na żądanie | |
| Combi-blocks | 1g | cena na żądanie | |
| Combi-blocks | 10g | cena na żądanie | |
| Combi-blocks | 25g | cena na żądanie | |
| Ambeed | 250mg | 303,62 Pln | |
| Ambeed | 1g | 442,69 Pln | |
| Ambeed | 5g | 1182,50 Pln | |
| BLDpharm | 250mg | 292,14 Pln | |
| BLDpharm | 1g | 469,86 Pln | |
| BLDpharm | 5g | 1269,58 Pln | |
| Chemat | 100mg | 155,60 Pln | |
| Chemat | 250mg | 213,20 Pln | |
| Chemat | 1g | 366,80 Pln | |
| Chemat | 5g | 986,00 Pln | |
| Chemat | 10g | 1763,60 Pln | |
| Chemat | 25g | 3467,60 Pln | |
| Fluorochem | 1g | 664,37 Pln | |
| Fluorochem | 5g | 1825,42 Pln | |
| Fluorochem | 1g | 430,07 Pln | |
| Fluorochem | 5g | 1174,60 Pln | |
| Fluorochem | 10g | 2278,38 Pln | |
| Fluorochem | 10g | 3257,20 Pln | |
| Fluorochem | 25g | 4610,89 Pln |
właściwości
| czystość | 98% |
|---|---|
| czas dostawy | 1-2 tygodnie, tylko jeżeli na stocku, by sprawdzić kliknij dostępność |
Methyl 2-amino-4-nitrobenzoate (CAS 3558-19-8) to związek chemiczny o wzorze sumarycznym C8H8N2O4 i masie molowej 196.16 g/mol. Nazwa systematyczna IUPAC: methyl 2-amino-4-nitrobenzoate. InChIKey: VGURYVWLCVIMTF-UHFFFAOYSA-N.
| Wzór sumaryczny | C8H8N2O4 |
|---|---|
| Masa molowa | 196.16 g/mol |
| Nazwa IUPAC | methyl 2-amino-4-nitrobenzoate |
| InChIKey | VGURYVWLCVIMTF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)[N+](=O)[O-])N |
Dane obliczone przez PubChem (NCBI)
Synonimy:
methyl 4-nitroanthranilate, Methyl 2-amino-4-nitrobenzoate, 2-amino-4-nitrobenzoic acid methyl ester, Benzoic acid, 2-amino-4-nitro-, methyl ester, 2-Amino-4-nitro-benzoic acid methyl ester, Anthranilic acid, 4-nitro-, methyl ester, methyl 2-amino-4-nitro-benzoate, Azilsartan impurity 145, Methyl2-amino-4-nitrobenzoate, 4-nitroanthranilic acid methyl ester