cas: 7560-44-3 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Methyl 3-(4-chlorophenyl)acrylate, 99%, 99% (CAS 7560-44-3) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1g, 5g, 10g, 15g, 25g, 50g, 75g, 100g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch116ARJ-1g |
| cas | 7560-44-3 |
| opakowanie | 1g |
| dostępność | 1500g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1g | 78,80 Pln | |
| Chemat | 5g | 83,60 Pln | |
| Chemat | 10g | 112,40 Pln | |
| Chemat | 15g | 136,40 Pln | |
| Chemat | 25g | 155,60 Pln | |
| Chemat | 50g | 237,20 Pln | |
| Chemat | 75g | 318,80 Pln | |
| Chemat | 100g | 395,60 Pln | |
| Chemat | 200g | 693,20 Pln | |
| Chemat | 300g | 1000,40 Pln |
| czystość | 99% |
|---|---|
| czas dostawy | 3 tygodnie |
Methyl (E)-3-(4-chlorophenyl)prop-2-enoate (CAS 7560-44-3) to związek chemiczny o wzorze sumarycznym C10H9ClO2 i masie molowej 196.63 g/mol. Nazwa systematyczna IUPAC: methyl (E)-3-(4-chlorophenyl)prop-2-enoate. InChIKey: IIBXQGYKZKOORG-QPJJXVBHSA-N.
| Wzór sumaryczny | C10H9ClO2 |
|---|---|
| Masa molowa | 196.63 g/mol |
| Nazwa IUPAC | methyl (E)-3-(4-chlorophenyl)prop-2-enoate |
| InChIKey | IIBXQGYKZKOORG-QPJJXVBHSA-N |
| SMILES | COC(=O)/C=C/C1=CC=C(C=C1)Cl |
Dane obliczone przez PubChem (NCBI)