cas: 812652-84-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Methyl 4,5-dimethoxy-1H-indole-2-carboxylate, 97%, 97% (CAS 812652-84-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11G3MB-100mg |
| cas | 812652-84-9 |
| opakowanie | 100mg |
| dostępność | 25g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 429,20 Pln | |
| Chemat | 250mg | 674,00 Pln | |
| Chemat | 500mg | 1086,80 Pln | |
| Chemat | 1g | 1590,80 Pln | |
| Chemat | 5g | 4653,20 Pln | |
| Chemat | 10g | 7715,60 Pln | |
| Chemat | 25g | 15371,60 Pln |
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
Methyl 4,5-dimethoxy-1H-indole-2-carboxylate (CAS 812652-84-9) to związek chemiczny o wzorze sumarycznym C12H13NO4 i masie molowej 235.24 g/mol. Nazwa systematyczna IUPAC: methyl 4,5-dimethoxy-1H-indole-2-carboxylate. InChIKey: MSOAVNPUVRAHBX-UHFFFAOYSA-N.
| Wzór sumaryczny | C12H13NO4 |
|---|---|
| Masa molowa | 235.24 g/mol |
| Nazwa IUPAC | methyl 4,5-dimethoxy-1H-indole-2-carboxylate |
| InChIKey | MSOAVNPUVRAHBX-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)NC(=C2)C(=O)OC)OC |
Dane obliczone przez PubChem (NCBI)