cas: 101909-42-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Methyl 4-chloro-1H-indole-3-carboxylate, 98%, 98% (CAS 101909-42-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch1116X4-100mg |
| cas | 101909-42-6 |
| opakowanie | 100mg |
| dostępność | 1000g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 93,20 Pln | |
| Chemat | 250mg | 122,00 Pln | |
| Chemat | 1g | 251,60 Pln | |
| Chemat | 5g | 683,60 Pln | |
| Chemat | 10g | 1029,20 Pln | |
| Chemat | 25g | 1576,40 Pln | |
| Chemat | 50g | 2819,60 Pln | |
| Chemat | 100g | 5574,80 Pln | |
| Chemat | 250g | 8915,60 Pln | |
| Chemat | 500g | 14889,60 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
Methyl 4-chloro-1H-indole-3-carboxylate (CAS 101909-42-6) to związek chemiczny o wzorze sumarycznym C10H8ClNO2 i masie molowej 209.63 g/mol. Nazwa systematyczna IUPAC: methyl 4-chloro-1H-indole-3-carboxylate. InChIKey: FCOPGKVFHCXUKH-UHFFFAOYSA-N.
| Wzór sumaryczny | C10H8ClNO2 |
|---|---|
| Masa molowa | 209.63 g/mol |
| Nazwa IUPAC | methyl 4-chloro-1H-indole-3-carboxylate |
| InChIKey | FCOPGKVFHCXUKH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CNC2=C1C(=CC=C2)Cl |
Dane obliczone przez PubChem (NCBI)