cas: 2007919-35-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Methyl 7-(trifluoromethyl)-1H-indazole-3-carboxylate, 98%, 98% (CAS 2007919-35-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch113CZK-100mg |
| cas | 2007919-35-7 |
| opakowanie | 100mg |
| dostępność | 5.1g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 352,40 Pln | |
| Chemat | 250mg | 558,80 Pln | |
| Chemat | 1g | 1413,20 Pln | |
| Chemat | 5g | 5243,60 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
Methyl 7-(trifluoromethyl)-2H-indazole-3-carboxylate (CAS 2007919-35-7) to związek chemiczny o wzorze sumarycznym C10H7F3N2O2 i masie molowej 244.17 g/mol. Nazwa systematyczna IUPAC: methyl 7-(trifluoromethyl)-2H-indazole-3-carboxylate. InChIKey: GEJLGIIAPUGJEN-UHFFFAOYSA-N.
| Wzór sumaryczny | C10H7F3N2O2 |
|---|---|
| Masa molowa | 244.17 g/mol |
| Nazwa IUPAC | methyl 7-(trifluoromethyl)-2H-indazole-3-carboxylate |
| InChIKey | GEJLGIIAPUGJEN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C=CC=C(C2=NN1)C(F)(F)F |
Dane obliczone przez PubChem (NCBI)