cas: 59237-53-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Methyl6-chloro-5-nitronicotinate, 97%, 97% (CAS 59237-53-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11460C-250mg |
| cas | 59237-53-5 |
| opakowanie | 250mg |
| dostępność | 1000g |
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 74,00 Pln | |
| Chemat | 1g | 74,00 Pln | |
| Chemat | 5g | 122,00 Pln | |
| Chemat | 10g | 179,60 Pln | |
| Chemat | 25g | 333,20 Pln | |
| Chemat | 50g | 582,80 Pln | |
| Chemat | 100g | 1067,60 Pln | |
| Chemat | 250g | 1994,00 Pln | |
| Chemat | 500g | 3921,60 Pln |
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
Methyl 6-chloro-5-nitropyridine-3-carboxylate (CAS 59237-53-5) to związek chemiczny o wzorze sumarycznym C7H5ClN2O4 i masie molowej 216.58 g/mol. Nazwa systematyczna IUPAC: methyl 6-chloro-5-nitropyridine-3-carboxylate. InChIKey: BRPREIDVQXJOJH-UHFFFAOYSA-N.
| Wzór sumaryczny | C7H5ClN2O4 |
|---|---|
| Masa molowa | 216.58 g/mol |
| Nazwa IUPAC | methyl 6-chloro-5-nitropyridine-3-carboxylate |
| InChIKey | BRPREIDVQXJOJH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N=C1)Cl)[N+](=O)[O-] |
Dane obliczone przez PubChem (NCBI)