cas: 26155-31-7 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
Morantel (tartrate), 99.01% (CAS 26155-31-7) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100 mg, 10mM/1mL, 5 mg, 25 mg, 10 mg, 50 mg. Oferty producentów: MedChemExpress.
| producent | MedChemExpress |
|---|---|
| nr katalogowy | HY-B1073-100 mg |
| cas | 26155-31-7 |
| opakowanie | 100 mg |
| dostępność | In stock |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| MedChemExpress | 100 mg | 886,26 Pln | |
| MedChemExpress | 10mM/1mL | 250,03 Pln | |
| MedChemExpress | 5 mg | 240,74 Pln | |
| MedChemExpress | 25 mg | 454,37 Pln | |
| MedChemExpress | 10 mg | 301,12 Pln | |
| MedChemExpress | 50 mg | 630,84 Pln |
| czas dostawy | 2-3 tygodnie |
|---|---|
| czystość | 99.01% |
(2R,3R)-2,3-dihydroxybutanedioic acid;1-methyl-2-[(E)-2-(3-methylthiophen-2-yl)ethenyl]-5,6-dihydro-4H-pyrimidine (CAS 26155-31-7) to związek chemiczny o wzorze sumarycznym C16H22N2O6S i masie molowej 370.4 g/mol. Nazwa systematyczna IUPAC: (2R,3R)-2,3-dihydroxybutanedioic acid;1-methyl-2-[(E)-2-(3-methylthiophen-2-yl)ethenyl]-5,6-dihydro-4H-pyrimidine. InChIKey: GGXQONWGCAQGNA-UUSVNAAPSA-N.
| Wzór sumaryczny | C16H22N2O6S |
|---|---|
| Masa molowa | 370.4 g/mol |
| Nazwa IUPAC | (2R,3R)-2,3-dihydroxybutanedioic acid;1-methyl-2-[(E)-2-(3-methylthiophen-2-yl)ethenyl]-5,6-dihydro-4H-pyrimidine |
| InChIKey | GGXQONWGCAQGNA-UUSVNAAPSA-N |
| SMILES | CC1=C(SC=C1)/C=C/C2=NCCCN2C.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Dane obliczone przez PubChem (NCBI)