cas: 254897-50-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
N,N'-((1,4-Phenylenebis(ethene-2,1-diyl))bis(4,1-phenylene))bis(2-ethyl-6-methyl-N-phenylaniline), 95%, 95% (CAS 254897-50-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch132OYR-100mg |
| cas | 254897-50-2 |
| opakowanie | 100mg |
| dostępność | 2g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 750,80 Pln | |
| Chemat | 250mg | 1096,40 Pln | |
| Chemat | 1g | 2128,40 Pln |
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
2-ethyl-N-[4-[(E)-2-[4-[(E)-2-[4-(N-(2-ethyl-6-methylphenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]phenyl]-6-methyl-N-phenylaniline (CAS 254897-50-2) to związek chemiczny o wzorze sumarycznym C52H48N2 i masie molowej 700.9 g/mol. Nazwa systematyczna IUPAC: 2-ethyl-N-[4-[(E)-2-[4-[(E)-2-[4-(N-(2-ethyl-6-methylphenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]phenyl]-6-methyl-N-phenylaniline. InChIKey: FYUHQGOEPWMNGM-QAVVBOBSSA-N.
| Wzór sumaryczny | C52H48N2 |
|---|---|
| Masa molowa | 700.9 g/mol |
| Nazwa IUPAC | 2-ethyl-N-[4-[(E)-2-[4-[(E)-2-[4-(N-(2-ethyl-6-methylphenyl)anilino)phenyl]ethenyl]phenyl]ethenyl]phenyl]-6-methyl-N-phenylaniline |
| InChIKey | FYUHQGOEPWMNGM-QAVVBOBSSA-N |
| SMILES | CCC1=CC=CC(=C1N(C2=CC=C(C=C2)/C=C/C3=CC=C(C=C3)/C=C/C4=CC=C(C=C4)N(C5=C(C=CC=C5CC)C)C6=CC=CC=C6)C7=CC=CC=C7)C |
Dane obliczone przez PubChem (NCBI)