cas: 2246772-82-5 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
N-(2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethanesulfonamide, 98%, 98% (CAS 2246772-82-5) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11UZD0-100mg |
| cas | 2246772-82-5 |
| opakowanie | 100mg |
| dostępność | 9.71g |
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 726,80 Pln | |
| Chemat | 250mg | 933,20 Pln | |
| Chemat | 1g | 1965,20 Pln | |
| Chemat | 5g | 7298,00 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide (CAS 2246772-82-5) to związek chemiczny o wzorze sumarycznym C14H21BFNO4S i masie molowej 329.2 g/mol. Nazwa systematyczna IUPAC: N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide. InChIKey: ILUZMWXSVTUWCY-UHFFFAOYSA-N.
| Wzór sumaryczny | C14H21BFNO4S |
|---|---|
| Masa molowa | 329.2 g/mol |
| Nazwa IUPAC | N-[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanesulfonamide |
| InChIKey | ILUZMWXSVTUWCY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)NS(=O)(=O)CC)F |
Dane obliczone przez PubChem (NCBI)