cas: 1454682-72-4 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
N-(3,3-Dimethylbutyl)-N'-[2-fluoro-4-methyl-5-[7-methyl-2-(methylamino)pyrido[2,3-d]pyrimidin-6-yl]phenyl]urea, 99%, 99% (CAS 1454682-72-4) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch112D2U-2mg |
| cas | 1454682-72-4 |
| opakowanie | 2mg |
| dostępność | 3g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 2mg | 150,80 Pln | |
| Chemat | 5mg | 242,00 Pln | |
| Chemat | 10mg | 328,40 Pln | |
| Chemat | 25mg | 486,80 Pln | |
| Chemat | 50mg | 856,40 Pln | |
| Chemat | 100mg | 1494,80 Pln | |
| Chemat | 250mg | 2507,60 Pln | |
| Chemat | 1g | 8157,20 Pln |
| czystość | 99% |
|---|---|
| czas dostawy | 3 tygodnie |
1-(3,3-dimethylbutyl)-3-[2-fluoro-4-methyl-5-[7-methyl-2-(methylamino)pyrido[2,3-d]pyrimidin-6-yl]phenyl]urea (CAS 1454682-72-4) to związek chemiczny o wzorze sumarycznym C23H29FN6O i masie molowej 424.5 g/mol. Nazwa systematyczna IUPAC: 1-(3,3-dimethylbutyl)-3-[2-fluoro-4-methyl-5-[7-methyl-2-(methylamino)pyrido[2,3-d]pyrimidin-6-yl]phenyl]urea. InChIKey: HHCBMISMPSAZBF-UHFFFAOYSA-N.
| Wzór sumaryczny | C23H29FN6O |
|---|---|
| Masa molowa | 424.5 g/mol |
| Nazwa IUPAC | 1-(3,3-dimethylbutyl)-3-[2-fluoro-4-methyl-5-[7-methyl-2-(methylamino)pyrido[2,3-d]pyrimidin-6-yl]phenyl]urea |
| InChIKey | HHCBMISMPSAZBF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C2=C(N=C3C(=C2)C=NC(=N3)NC)C)NC(=O)NCCC(C)(C)C)F |
Dane obliczone przez PubChem (NCBI)