N-(3-(4-Fluorophenylsulfonamido)-4-hydroxyphenyl)-[1,1'-biphenyl]-4-carboxamide, 98+%, 98+%
cas: 2249435-90-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
N-(3-(4-Fluorophenylsulfonamido)-4-hydroxyphenyl)-[1,1'-biphenyl]-4-carboxamide, 98+%, 98+% (CAS 2249435-90-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch12V6OE-1mg |
| cas | 2249435-90-1 |
| opakowanie | 1mg |
| dostępność | 2g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1mg | 107,60 Pln | |
| Chemat | 5mg | 184,40 Pln | |
| Chemat | 10mg | 246,80 Pln | |
| Chemat | 25mg | 429,20 Pln | |
| Chemat | 50mg | 606,80 Pln | |
| Chemat | 100mg | 952,40 Pln | |
| Chemat | 250mg | 1754,00 Pln | |
| Chemat | 1g | 4830,80 Pln |
właściwości
| czystość | 98+% |
|---|---|
| czas dostawy | 3 tygodnie |
N-[3-[(4-fluorophenyl)sulfonylamino]-4-hydroxyphenyl]-4-phenylbenzamide (CAS 2249435-90-1) to związek chemiczny o wzorze sumarycznym C25H19FN2O4S i masie molowej 462.5 g/mol. Nazwa systematyczna IUPAC: N-[3-[(4-fluorophenyl)sulfonylamino]-4-hydroxyphenyl]-4-phenylbenzamide. InChIKey: GPXQUPCJIJBXHJ-UHFFFAOYSA-N.
| Wzór sumaryczny | C25H19FN2O4S |
|---|---|
| Masa molowa | 462.5 g/mol |
| Nazwa IUPAC | N-[3-[(4-fluorophenyl)sulfonylamino]-4-hydroxyphenyl]-4-phenylbenzamide |
| InChIKey | GPXQUPCJIJBXHJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)NC3=CC(=C(C=C3)O)NS(=O)(=O)C4=CC=C(C=C4)F |
Dane obliczone przez PubChem (NCBI)
Synonimy:
N-[3-(4-fluorobenzenesulfonamido)-4-hydroxyphenyl]-[1,1'-biphenyl]-4-carboxamide, N-(3-(4-fluorobenzenesulfonamido)-4-hydroxyphenyl)-(1,1'-biphenyl)-4-carboxamide, N-(3-(4-Fluorophenylsulfonamido)-4-hydroxyphenyl)-[1,1'-biphenyl]-4-carboxamide, N-[3-[(4-Fluorophenyl)sulfonylamino]-4-hydroxyphenyl]-4-phenylbenzamide, orb1218392, orb1298339, N-(3-(4-Fluorophenylsulfonylamino)-4-hydroxyphenyl)-4-biphenylcarboxamide, N-[3-(4-Fluorophenylsulfonamido)-4-hydroxyphenyl]biphenyl-4-carboxamide, N-[3-[(4-fluorophenyl)sulfonylamino]-4-oxidanyl-phenyl]-4-phenyl-benzamide