cas: 2674175-12-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
N-(dibenzo[b,d]furan-3-yl)-N-(3-(9-phenyl-9H-fluoren-9-yl)phenyl)spiro[fluorene-9,9'-xanthen]-2'-amine, 95%, 95% (CAS 2674175-12-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch1F2CCB-100mg |
| cas | 2674175-12-1 |
| opakowanie | 100mg |
| dostępność | 10g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 338,00 Pln | |
| Chemat | 250mg | 578,00 Pln | |
| Chemat | 1g | 1096,40 Pln | |
| Chemat | 5g | 3165,20 Pln |
| czystość | 95% |
|---|---|
| czas dostawy | 3 tygodnie |
N-dibenzofuran-3-yl-N-[3-(9-phenylfluoren-9-yl)phenyl]spiro[fluorene-9,9'-xanthene]-2'-amine (CAS 2674175-12-1) to związek chemiczny o wzorze sumarycznym C62H39NO2 i masie molowej 830.0 g/mol. Nazwa systematyczna IUPAC: N-dibenzofuran-3-yl-N-[3-(9-phenylfluoren-9-yl)phenyl]spiro[fluorene-9,9'-xanthene]-2'-amine. InChIKey: NOFFKXIFVVPLPF-UHFFFAOYSA-N.
| Wzór sumaryczny | C62H39NO2 |
|---|---|
| Masa molowa | 830.0 g/mol |
| Nazwa IUPAC | N-dibenzofuran-3-yl-N-[3-(9-phenylfluoren-9-yl)phenyl]spiro[fluorene-9,9'-xanthene]-2'-amine |
| InChIKey | NOFFKXIFVVPLPF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(C3=CC=CC=C3C4=CC=CC=C42)C5=CC(=CC=C5)N(C6=CC7=C(C=C6)OC8=CC=CC=C8C79C1=CC=CC=C1C1=CC=CC=C91)C1=CC2=C(C=C1)C1=CC=CC=C1O2 |
Dane obliczone przez PubChem (NCBI)