cas: 293753-05-6 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
N-[4-[2,2,2-Trifluoro-1-hydroxy-1-(trifluoromethyl)ethyl]phenyl]-2-thiophenesulfonamide, 98%, 98% (CAS 293753-05-6) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 1mg, 5mg, 10mg, 25mg, 50mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch113Y8V-1mg |
| cas | 293753-05-6 |
| opakowanie | 1mg |
| dostępność | 0.15g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 1mg | 117,20 Pln | |
| Chemat | 5mg | 126,80 Pln | |
| Chemat | 10mg | 174,80 Pln | |
| Chemat | 25mg | 285,20 Pln | |
| Chemat | 50mg | 443,60 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]thiophene-2-sulfonamide (CAS 293753-05-6) to związek chemiczny o wzorze sumarycznym C13H9F6NO3S2 i masie molowej 405.3 g/mol. Nazwa systematyczna IUPAC: N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]thiophene-2-sulfonamide. InChIKey: LZWUNZRMANFRAO-UHFFFAOYSA-N.
| Wzór sumaryczny | C13H9F6NO3S2 |
|---|---|
| Masa molowa | 405.3 g/mol |
| Nazwa IUPAC | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]thiophene-2-sulfonamide |
| InChIKey | LZWUNZRMANFRAO-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)S(=O)(=O)NC2=CC=C(C=C2)C(C(F)(F)F)(C(F)(F)F)O |
Dane obliczone przez PubChem (NCBI)