N1,N2-Dibenzylideneethane-1,2-diamine, 97%
cas: 104-71-2 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
N1,N2-Dibenzylideneethane-1,2-diamine, 97% (CAS 104-71-2) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 5g, 10g, 25g, 100g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch119SI2-250mg |
| cas | 104-71-2 |
| opakowanie | 250mg |
| dostępność | 200g |
Potrzebujesz dodatkowych informacji?
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
Dostępne opakowania
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 88,40 Pln | |
| Chemat | 1g | 107,60 Pln | |
| Chemat | 5g | 198,80 Pln | |
| Chemat | 10g | 294,80 Pln | |
| Chemat | 25g | 530,00 Pln | |
| Chemat | 100g | 1302,80 Pln |
właściwości
| czystość | 97% |
|---|---|
| czas dostawy | 3 tygodnie |
N-[2-(benzylideneamino)ethyl]-1-phenylmethanimine (CAS 104-71-2) to związek chemiczny o wzorze sumarycznym C16H16N2 i masie molowej 236.31 g/mol. Nazwa systematyczna IUPAC: N-[2-(benzylideneamino)ethyl]-1-phenylmethanimine. InChIKey: QBAKBJNOARBSGP-UHFFFAOYSA-N.
| Wzór sumaryczny | C16H16N2 |
|---|---|
| Masa molowa | 236.31 g/mol |
| Nazwa IUPAC | N-[2-(benzylideneamino)ethyl]-1-phenylmethanimine |
| InChIKey | QBAKBJNOARBSGP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C=NCCN=CC2=CC=CC=C2 |
Dane obliczone przez PubChem (NCBI)
Synonimy:
N,N'-Dibenzylideneethylenediamine, N,N'-Bis(benzylidene)ethylenediamine, Ethylenediamine, N,N'-dibenzylidene-, 1,2-Ethanediamine, N1,N2-bis(phenylmethylene)-, Ethylenediamine, N,N'-dibenzylidene-(8CI), N1,N2-Dibenzylideneethane-1,2-diamine, Dibenzylidene ethylenediamine, N-[2-(benzylideneamino)ethyl]-1-phenylmethanimine, 1,2-Ethanediamine, N,N'-bis(phenylmethylene)-, N,N'-(Ethane-1,2-diyl)bis(1-phenylmethanimine)