cas: 185690-41-9 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
N1-(Naphthalen-2-yl)-N4,N4-bis(4-(naphthalen-2-yl(phenyl)amino)phenyl)-N1-phenylbenzene-1,4-diamine, 98%, 98% (CAS 185690-41-9) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 100mg, 250mg, 1g, 5g, 25g, 10g, 15g. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch11I2KK-100mg |
| cas | 185690-41-9 |
| opakowanie | 100mg |
| dostępność | 250g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 100mg | 107,60 Pln | |
| Chemat | 250mg | 155,60 Pln | |
| Chemat | 1g | 309,20 Pln | |
| Chemat | 5g | 1134,80 Pln | |
| Chemat | 25g | 4662,80 Pln | |
| Chemat | 10g | 2162,00 Pln | |
| Chemat | 15g | 3117,20 Pln |
| czystość | 98% |
|---|---|
| czas dostawy | 3 tygodnie |
4-N-naphthalen-2-yl-1-N,1-N-bis[4-(N-naphthalen-2-ylanilino)phenyl]-4-N-phenylbenzene-1,4-diamine (CAS 185690-41-9) to związek chemiczny o wzorze sumarycznym C66H48N4 i masie molowej 897.1 g/mol. Nazwa systematyczna IUPAC: 4-N-naphthalen-2-yl-1-N,1-N-bis[4-(N-naphthalen-2-ylanilino)phenyl]-4-N-phenylbenzene-1,4-diamine. InChIKey: KDOQMLIRFUVJNT-UHFFFAOYSA-N.
| Wzór sumaryczny | C66H48N4 |
|---|---|
| Masa molowa | 897.1 g/mol |
| Nazwa IUPAC | 4-N-naphthalen-2-yl-1-N,1-N-bis[4-(N-naphthalen-2-ylanilino)phenyl]-4-N-phenylbenzene-1,4-diamine |
| InChIKey | KDOQMLIRFUVJNT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=C(C=C2)N(C3=CC=C(C=C3)N(C4=CC=CC=C4)C5=CC6=CC=CC=C6C=C5)C7=CC=C(C=C7)N(C8=CC=CC=C8)C9=CC1=CC=CC=C1C=C9)C1=CC2=CC=CC=C2C=C1 |
Dane obliczone przez PubChem (NCBI)