cas: 182507-83-1 — zobacz wszystkie produkty o tym numerze CAS, także pod innymi nazwami
N4,N4'-Di(phenanthren-9-yl)-N4,N4'-diphenyl-[1,1'-biphenyl]-4,4'-diamine (CAS 182507-83-1) to odczynnik chemiczny dostępny w ofercie Chemat. Dostępne opakowania: 250mg, 1g, 100mg, 200mg. Oferty producentów: Chemat.
| producent | Chemat |
|---|---|
| nr katalogowy | Ch1134Y6-250mg |
| cas | 182507-83-1 |
| opakowanie | 250mg |
| dostępność | 9g |
Zadaj nam pytanie o ten produkt — chętnie pomożemy.
| producent | opakowanie | cena | |
|---|---|---|---|
| Chemat | 250mg | 438,80 Pln | |
| Chemat | 1g | 1096,40 Pln | |
| Chemat | 100mg | 261,20 Pln | |
| Chemat | 200mg | 386,00 Pln |
| czas dostawy | 3 tygodnie |
|---|
N-[4-[4-(N-phenanthren-9-ylanilino)phenyl]phenyl]-N-phenylphenanthren-9-amine (CAS 182507-83-1) to związek chemiczny o wzorze sumarycznym C52H36N2 i masie molowej 688.9 g/mol. Nazwa systematyczna IUPAC: N-[4-[4-(N-phenanthren-9-ylanilino)phenyl]phenyl]-N-phenylphenanthren-9-amine. InChIKey: LBFXFIPIIMAZPK-UHFFFAOYSA-N.
| Wzór sumaryczny | C52H36N2 |
|---|---|
| Masa molowa | 688.9 g/mol |
| Nazwa IUPAC | N-[4-[4-(N-phenanthren-9-ylanilino)phenyl]phenyl]-N-phenylphenanthren-9-amine |
| InChIKey | LBFXFIPIIMAZPK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=C(C=C2)C3=CC=C(C=C3)N(C4=CC=CC=C4)C5=CC6=CC=CC=C6C7=CC=CC=C75)C8=CC9=CC=CC=C9C1=CC=CC=C18 |
Dane obliczone przez PubChem (NCBI)